In the realm of biochemical research and peptide synthesis, understanding the tripeptide molecular formula is fundamental for anyone working with these versatile protein fragments. As a dedicated enthusiast of peptide science, I h Chemical Formula: C12H19N3O5. Molecular Weight: 285.30 g/mol. Synonyms : Ac-Pro-Gly-Ala;Ac-PGA-OH. Division, Code, Description, Spec, Pricing. R&D · VAC-00040. ave spent considerable time exploring the complexities of these chains, which are essentially small protein fragments consisting of three amino acids linked by peptide bonds.
Dec Molecular Weight, 302.33. Formula, C12H22N4O5. Cas No. 1185583-20-3. Smiles, C([C@@H](NC([C@H](CO)N)=O)[C@@H](C)O)(=O)N1[C@H](C(N)=O)CCC1. oding the Molecular Structure
When analyzing any specific tripeptide, the primary challenge often lies in determining the precise formula and structure. Because these molecules are composed of three amino acid residues, the final composition depends heavily on the specific side chains involved. For example, while some simpler chains might present as C3H7NO3 (in the context of specific constituent amino acids like serine), more complex functional peptides, such as Tripeptide-32, carry a specific C12H22N4O5 configuration.
One of the most frequently stu How many amino acids are present in a tripeptide? died examples in the community is Glutathione, identified chemically as γ-l-glutamyl-l-cysteinyl-glycine. Its role as an antioxidant is widely documented, and it serves as a benchmark for understanding how these molecules function within biological systems.
Essential Data for Precise Analysis
To accurately determine the properties of a peptide, researchers often rely on a molecular weight peptide calculator. When performing these calculations, one must account for the loss of water molecules during the formation of the three amino acids linked by peptide bonds. A common observation in the lab is that the mass of a tripeptide like Trp-Gly-His is approximately 398.47 Da, a value derived by subtracting the mass of the water molecules lost during the condensation reaction.
For those interested in analytical chemistry, the conversion efficiency is often monitored using the ratio: [Atri/(Adi + Atri)] × 100, where *Atri* and *Adi* represent the respective areas under the curve for tripeptides and dipeptides in a chromatogram.
Noteworth Tripeptide y Variations and Specifications
In my personal experience working with various compounds, I have encountered significant variations in chemical signatures:
* Tripeptide-1: Often identified by the formula C16H28N6O6, this is a staple in many advanced research protocols.
* Biotinoyl Tripeptide-1: A more complex derivative with the formula C24H38N8O6S, frequently utilized for its unique structural properties.
* Custom Synthetics: I have worked with compounds like C24H35N7O, which highlight the diversity of these chains.
Practical Considerations for Handling
When handling these substances, maintaining proper storage conditions is paramount. While some variants remain stable at ambient temperatures, others, like Biotinoyl Tripeptide-1, are best kept in a refrigerator (2-8°C) to preserve their integrity. Always ensure you are working with high-purity samples to avoid discrepancies in your tripeptide structure analysis.
If you are drafting a tripeptide sequence, remember that the s-OH terminus and the specific orientation of the a Q38P a. Draw the structure of the tri [FREE SOLUTION] - Vaia mino group are critical to the molecule's overall identity. Whether you are using a tripeptide structure generator or calculating the mass manually, the attention to de How many amino acids are present in a tripeptide? tail in your chemical inputs will dictate the success of your observations.
By grounding your research in these verifiable formulas and structural principles, you gain a deeper appreciation for the intricate design of these essential peptide chains.